C23H27N2O3P — CID 91582242
4-diphenylphosphanyl-2-(4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)pyrrolidine-1-carboxylic acid (PubChem CID 91582242) has the molecular formula C23H27N2O3P and a molecular weight of 410.45 g/mol. Its IUPAC name is 4-diphenylphosphanyl-2-(4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)pyrrolidine-1-carboxylic acid.
| Compound Name | 4-diphenylphosphanyl-2-(4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 91582242 |
| Molecular Formula | C23H27N2O3P |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 4-diphenylphosphanyl-2-(4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)pyrrolidine-1-carboxylic acid |
| SMILES | CC(C)C1COC(C2CC(P(c3ccccc3)c3ccccc3)CN2C(=O)O)=N1 |
| InChI | InChI=1S/C23H27N2O3P/c1-16(2)20-15-28-22(24-20)21-13-19(14-25(21)23(26)27)29(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-12,16,19-21H,13-15H2,1-2H3,(H,26,27) |
| InChIKey | PJHALQUPIZPFIX-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|