C22H38FN3 — CID 91582284
3-fluoro-7-methyl-1-(2-methyl-2,5-dihydropyridin-3-yl)-7-propan-2-yldodeca-2,4-diene-1,6-diamine (PubChem CID 91582284) has the molecular formula C22H38FN3 and a molecular weight of 363.57 g/mol. Its IUPAC name is 3-fluoro-7-methyl-1-(2-methyl-2,5-dihydropyridin-3-yl)-7-propan-2-yldodeca-2,4-diene-1,6-diamine.
| Compound Name | 3-fluoro-7-methyl-1-(2-methyl-2,5-dihydropyridin-3-yl)-7-propan-2-yldodeca-2,4-diene-1,6-diamine |
|---|---|
| PubChem CID | 91582284 |
| Molecular Formula | C22H38FN3 |
| Molecular Weight | 363.57 g/mol |
| Exact Mass | 363.30 |
| IUPAC Name | 3-fluoro-7-methyl-1-(2-methyl-2,5-dihydropyridin-3-yl)-7-propan-2-yldodeca-2,4-diene-1,6-diamine |
| SMILES | CCCCCC(C)(C(C)C)C(N)C=CC(F)=CC(N)C1=CCC=NC1C |
| InChI | InChI=1S/C22H38FN3/c1-6-7-8-13-22(5,16(2)3)21(25)12-11-18(23)15-20(24)19-10-9-14-26-17(19)4/h10-12,14-17,20-21H,6-9,13,24-25H2,1-5H3 |
| InChIKey | ZUWUSIHMKNGMSU-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.57 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|