C24H29F6NO4 — CID 91583060
1-[4-[[4,6-dipropyl-1,1-bis(trifluoromethyl)-3H-2-benzofuran-5-yl]oxy]butyl]pyrrole-2,5-diol (PubChem CID 91583060) has the molecular formula C24H29F6NO4 and a molecular weight of 509.49 g/mol. Its IUPAC name is 1-[4-[[4,6-dipropyl-1,1-bis(trifluoromethyl)-3H-2-benzofuran-5-yl]oxy]butyl]pyrrole-2,5-diol.
| Compound Name | 1-[4-[[4,6-dipropyl-1,1-bis(trifluoromethyl)-3H-2-benzofuran-5-yl]oxy]butyl]pyrrole-2,5-diol |
|---|---|
| PubChem CID | 91583060 |
| Molecular Formula | C24H29F6NO4 |
| Molecular Weight | 509.49 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | 1-[4-[[4,6-dipropyl-1,1-bis(trifluoromethyl)-3H-2-benzofuran-5-yl]oxy]butyl]pyrrole-2,5-diol |
| SMILES | CCCc1cc2c(c(CCC)c1OCCCCn1c(O)ccc1O)COC2(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C24H29F6NO4/c1-3-7-15-13-18-17(14-35-22(18,23(25,26)27)24(28,29)30)16(8-4-2)21(15)34-12-6-5-11-31-19(32)9-10-20(31)33/h9-10,13,32-33H,3-8,11-12,14H2,1-2H3 |
| InChIKey | NTJZIPUHUUPLMS-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 63.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.49 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|