C34H36N2O5S+2 — CID 91583195
2,6-dimethyl-4-(8-methyl-2H-1,3-benzoxazin-3-ium-3-yl)benzenesulfonic acid;3-(3,5-dimethylphenyl)-8-methyl-2H-1,3-benzoxazin-3-ium (PubChem CID 91583195) has the molecular formula C34H36N2O5S+2 and a molecular weight of 584.74 g/mol. Its IUPAC name is 2,6-dimethyl-4-(8-methyl-2H-1,3-benzoxazin-3-ium-3-yl)benzenesulfonic acid;3-(3,5-dimethylphenyl)-8-methyl-2H-1,3-benzoxazin-3-ium.
| Compound Name | 2,6-dimethyl-4-(8-methyl-2H-1,3-benzoxazin-3-ium-3-yl)benzenesulfonic acid;3-(3,5-dimethylphenyl)-8-methyl-2H-1,3-benzoxazin-3-ium |
|---|---|
| PubChem CID | 91583195 |
| Molecular Formula | C34H36N2O5S+2 |
| Molecular Weight | 584.74 g/mol |
| Exact Mass | 584.23 |
| IUPAC Name | 2,6-dimethyl-4-(8-methyl-2H-1,3-benzoxazin-3-ium-3-yl)benzenesulfonic acid;3-(3,5-dimethylphenyl)-8-methyl-2H-1,3-benzoxazin-3-ium |
| SMILES | Cc1cc(C)cc([N+]2=Cc3cccc(C)c3OC2)c1.Cc1cccc2c1OC[N+](c1cc(C)c(S(=O)(=O)O)c(C)c1)=C2 |
| InChI | InChI=1S/C17H17NO4S.C17H18NO/c1-11-5-4-6-14-9-18(10-22-16(11)14)15-7-12(2)17(13(3)8-15)23(19,20)21;1-12-7-13(2)9-16(8-12)18-10-15-6-4-5-14(3)17(15)19-11-18/h4-9H,10H2,1-3H3;4-10H,11H2,1-3H3/q;+1/p+1 |
| InChIKey | AVEFKRKNIQMNBE-UHFFFAOYSA-O |
| XLogP | 6.70 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.74 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|