About 5-(methylamino)pentanoic acid
5-(methylamino)pentanoic acid (PubChem CID 91583432) has the molecular formula C12H26N2O4
and a molecular weight of 262.35 g/mol. Its IUPAC name is 5-(methylamino)pentanoic acid.
Molecular Properties
| Compound Name | 5-(methylamino)pentanoic acid |
| PubChem CID | 91583432 |
| Molecular Formula | C12H26N2O4 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 5-(methylamino)pentanoic acid |
| SMILES | CNCCCCC(=O)O.CNCCCCC(=O)O |
| InChI | InChI=1S/2C6H13NO2/c2*1-7-5-3-2-4-6(8)9/h2*7H,2-5H2,1H3,(H,8,9) |
| InChIKey | HSIJMDDHVMYFNS-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(methylamino)pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(methylamino)pentanoic acid?
The IUPAC name of 5-(methylamino)pentanoic acid (CID 91583432) is 5-(methylamino)pentanoic acid.
What is the SMILES notation for 5-(methylamino)pentanoic acid?
The canonical SMILES for 5-(methylamino)pentanoic acid is CNCCCCC(=O)O.CNCCCCC(=O)O.
What is the InChIKey of 5-(methylamino)pentanoic acid?
The InChIKey is HSIJMDDHVMYFNS-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H13NO2/c2*1-7-5-3-2-4-6(8)9/h2*7H,2-5H2,1H3,(H,8,9).
What are the key properties of 5-(methylamino)pentanoic acid?
5-(methylamino)pentanoic acid has a molecular weight of 262.35 g/mol, XLogP of 0.92, 10 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(methylamino)pentanoic acid is sourced from PubChem (CID 91583432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).