C15H22 — CID 91583906
1,2,3,4-tetramethyl-5-pent-4-enylbenzene (PubChem CID 91583906) has the molecular formula C15H22 and a molecular weight of 202.34 g/mol. Its IUPAC name is 1,2,3,4-tetramethyl-5-pent-4-enylbenzene.
| Compound Name | 1,2,3,4-tetramethyl-5-pent-4-enylbenzene |
|---|---|
| PubChem CID | 91583906 |
| Molecular Formula | C15H22 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 1,2,3,4-tetramethyl-5-pent-4-enylbenzene |
| SMILES | C=CCCCc1cc(C)c(C)c(C)c1C |
| InChI | InChI=1S/C15H22/c1-6-7-8-9-15-10-11(2)12(3)13(4)14(15)5/h6,10H,1,7-9H2,2-5H3 |
| InChIKey | PMKXCGYUFOSTQA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|