C20H16Cl2F4O5 — CID 91583963
methyl 2-[2-[[3,5-dichloro-4-(1,1,2,2-tetrafluoroethoxy)phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate (PubChem CID 91583963) has the molecular formula C20H16Cl2F4O5 and a molecular weight of 483.24 g/mol. Its IUPAC name is methyl 2-[2-[[3,5-dichloro-4-(1,1,2,2-tetrafluoroethoxy)phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl 2-[2-[[3,5-dichloro-4-(1,1,2,2-tetrafluoroethoxy)phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 91583963 |
| Molecular Formula | C20H16Cl2F4O5 |
| Molecular Weight | 483.24 g/mol |
| Exact Mass | 482.03 |
| IUPAC Name | methyl 2-[2-[[3,5-dichloro-4-(1,1,2,2-tetrafluoroethoxy)phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate |
| SMILES | COC=C(C(=O)OC)c1ccccc1COc1cc(Cl)c(OC(F)(F)C(F)F)c(Cl)c1 |
| InChI | InChI=1S/C20H16Cl2F4O5/c1-28-10-14(18(27)29-2)13-6-4-3-5-11(13)9-30-12-7-15(21)17(16(22)8-12)31-20(25,26)19(23)24/h3-8,10,19H,9H2,1-2H3 |
| InChIKey | SOEFYIXKKIQKOD-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.24 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|