C38H47N5O8S — CID 91584117
2-[2-[5-[6-isocyano-7-(2,4,6-trimethylcyclohexyl)oxycarbonyl-3H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]-2-methoxyanilino]-4-methylphenoxy]octanoic acid;sulfur dioxide (PubChem CID 91584117) has the molecular formula C38H47N5O8S and a molecular weight of 733.89 g/mol. Its IUPAC name is 2-[2-[5-[6-isocyano-7-(2,4,6-trimethylcyclohexyl)oxycarbonyl-3H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]-2-methoxyanilino]-4-methylphenoxy]octanoic acid;sulfur dioxide.
| Compound Name | 2-[2-[5-[6-isocyano-7-(2,4,6-trimethylcyclohexyl)oxycarbonyl-3H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]-2-methoxyanilino]-4-methylphenoxy]octanoic acid;sulfur dioxide |
|---|---|
| PubChem CID | 91584117 |
| Molecular Formula | C38H47N5O8S |
| Molecular Weight | 733.89 g/mol |
| Exact Mass | 733.31 |
| IUPAC Name | 2-[2-[5-[6-isocyano-7-(2,4,6-trimethylcyclohexyl)oxycarbonyl-3H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]-2-methoxyanilino]-4-methylphenoxy]octanoic acid;sulfur dioxide |
| SMILES | O=S=O.[C-]#[N+]c1cn2[nH]c(-c3ccc(OC)c(Nc4cc(C)ccc4OC(CCCCCC)C(=O)O)c3)nc2c1C(=O)OC1C(C)CC(C)CC1C |
| InChI | InChI=1S/C38H47N5O6.O2S/c1-8-9-10-11-12-32(37(44)45)48-31-15-13-22(2)19-27(31)40-28-20-26(14-16-30(28)47-7)35-41-36-33(29(39-6)21-43(36)42-35)38(46)49-34-24(4)17-23(3)18-25(34)5;1-3-2/h13-16,19-21,23-25,32,34,40H,8-12,17-18H2,1-5,7H3,(H,41,42)(H,44,45); |
| InChIKey | OIQHNWQRBRETSG-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 165.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.89 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|