C16H33NO — CID 91584276
4-(2,4,4,5,5-pentamethylheptan-2-yl)morpholine (PubChem CID 91584276) has the molecular formula C16H33NO and a molecular weight of 255.45 g/mol. Its IUPAC name is 4-(2,4,4,5,5-pentamethylheptan-2-yl)morpholine.
| Compound Name | 4-(2,4,4,5,5-pentamethylheptan-2-yl)morpholine |
|---|---|
| PubChem CID | 91584276 |
| Molecular Formula | C16H33NO |
| Molecular Weight | 255.45 g/mol |
| Exact Mass | 255.26 |
| IUPAC Name | 4-(2,4,4,5,5-pentamethylheptan-2-yl)morpholine |
| SMILES | CCC(C)(C)C(C)(C)CC(C)(C)N1CCOCC1 |
| InChI | InChI=1S/C16H33NO/c1-8-14(2,3)15(4,5)13-16(6,7)17-9-11-18-12-10-17/h8-13H2,1-7H3 |
| InChIKey | MBPVHSIDSXURHG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |