C10H21NO4 — CID 91584452
[(2S)-2,3-dimethoxypropyl] N-tert-butylcarbamate (PubChem CID 91584452) has the molecular formula C10H21NO4 and a molecular weight of 219.28 g/mol. Its IUPAC name is [(2S)-2,3-dimethoxypropyl] N-tert-butylcarbamate.
| Compound Name | [(2S)-2,3-dimethoxypropyl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 91584452 |
| Molecular Formula | C10H21NO4 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | [(2S)-2,3-dimethoxypropyl] N-tert-butylcarbamate |
| SMILES | COC[C@@H](COC(=O)NC(C)(C)C)OC |
| InChI | InChI=1S/C10H21NO4/c1-10(2,3)11-9(12)15-7-8(14-5)6-13-4/h8H,6-7H2,1-5H3,(H,11,12)/t8-/m0/s1 |
| InChIKey | DWFFPTABSFJZIL-QMMMGPOBSA-N |
| XLogP | 1.17 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |