C23H20F2N4OS — CID 91584686
3-fluoro-2-(1-fluoroethenyl)-N-[5-[5-methyl-2-(2-pyridin-3-ylethyl)-1,3-thiazol-4-yl]-2-pyridinyl]penta-2,4-dienamide (PubChem CID 91584686) has the molecular formula C23H20F2N4OS and a molecular weight of 438.50 g/mol. Its IUPAC name is 3-fluoro-2-(1-fluoroethenyl)-N-[5-[5-methyl-2-(2-pyridin-3-ylethyl)-1,3-thiazol-4-yl]-2-pyridinyl]penta-2,4-dienamide.
| Compound Name | 3-fluoro-2-(1-fluoroethenyl)-N-[5-[5-methyl-2-(2-pyridin-3-ylethyl)-1,3-thiazol-4-yl]-2-pyridinyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 91584686 |
| Molecular Formula | C23H20F2N4OS |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | 3-fluoro-2-(1-fluoroethenyl)-N-[5-[5-methyl-2-(2-pyridin-3-ylethyl)-1,3-thiazol-4-yl]-2-pyridinyl]penta-2,4-dienamide |
| SMILES | C=CC(F)=C(C(=C)F)C(=O)Nc1ccc(-c2nc(CCc3cccnc3)sc2C)cn1 |
| InChI | InChI=1S/C23H20F2N4OS/c1-4-18(25)21(14(2)24)23(30)28-19-9-8-17(13-27-19)22-15(3)31-20(29-22)10-7-16-6-5-11-26-12-16/h4-6,8-9,11-13H,1-2,7,10H2,3H3,(H,27,28,30) |
| InChIKey | FOBZEIGBRJVWIG-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|