C35H30N2O5S3 — CID 91585070
ethanesulfonate;5-(furan-2-yl)-2-[3-[5-(furan-2-yl)-3-methyl-1,3-benzothiazol-3-ium-2-yl]-2-phenylprop-2-enylidene]-3-methyl-1,3-benzothiazole (PubChem CID 91585070) has the molecular formula C35H30N2O5S3 and a molecular weight of 654.84 g/mol. Its IUPAC name is ethanesulfonate;5-(furan-2-yl)-2-[3-[5-(furan-2-yl)-3-methyl-1,3-benzothiazol-3-ium-2-yl]-2-phenylprop-2-enylidene]-3-methyl-1,3-benzothiazole.
| Compound Name | ethanesulfonate;5-(furan-2-yl)-2-[3-[5-(furan-2-yl)-3-methyl-1,3-benzothiazol-3-ium-2-yl]-2-phenylprop-2-enylidene]-3-methyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 91585070 |
| Molecular Formula | C35H30N2O5S3 |
| Molecular Weight | 654.84 g/mol |
| Exact Mass | 654.13 |
| IUPAC Name | ethanesulfonate;5-(furan-2-yl)-2-[3-[5-(furan-2-yl)-3-methyl-1,3-benzothiazol-3-ium-2-yl]-2-phenylprop-2-enylidene]-3-methyl-1,3-benzothiazole |
| SMILES | CCS(=O)(=O)[O-].CN1C(=CC(=Cc2sc3ccc(-c4ccco4)cc3[n+]2C)c2ccccc2)Sc2ccc(-c3ccco3)cc21 |
| InChI | InChI=1S/C33H25N2O2S2.C2H6O3S/c1-34-26-18-23(28-10-6-16-36-28)12-14-30(26)38-32(34)20-25(22-8-4-3-5-9-22)21-33-35(2)27-19-24(13-15-31(27)39-33)29-11-7-17-37-29;1-2-6(3,4)5/h3-21H,1-2H3;2H2,1H3,(H,3,4,5)/q+1;/p-1 |
| InChIKey | IBQWBUHTAGSNBK-UHFFFAOYSA-M |
| XLogP | 8.42 |
| TPSA | 90.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.84 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|