C18H13F2NOS — CID 91585755
2-benzylsulfanyl-6-(2,4-difluorophenoxy)pyridine (PubChem CID 91585755) has the molecular formula C18H13F2NOS and a molecular weight of 329.37 g/mol. Its IUPAC name is 2-benzylsulfanyl-6-(2,4-difluorophenoxy)pyridine.
| Compound Name | 2-benzylsulfanyl-6-(2,4-difluorophenoxy)pyridine |
|---|---|
| PubChem CID | 91585755 |
| Molecular Formula | C18H13F2NOS |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 2-benzylsulfanyl-6-(2,4-difluorophenoxy)pyridine |
| SMILES | Fc1ccc(Oc2cccc(SCc3ccccc3)n2)c(F)c1 |
| InChI | InChI=1S/C18H13F2NOS/c19-14-9-10-16(15(20)11-14)22-17-7-4-8-18(21-17)23-12-13-5-2-1-3-6-13/h1-11H,12H2 |
| InChIKey | VARGVASBGBBRBK-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |