C23H16N2O4S — CID 91586243
4-hydroxy-5-[(4R)-7-(4-isocyanonaphthalen-1-yl)oxy-3,4-dihydro-2H-chromen-4-yl]-3H-1,3-thiazol-2-one (PubChem CID 91586243) has the molecular formula C23H16N2O4S and a molecular weight of 416.46 g/mol. Its IUPAC name is 4-hydroxy-5-[(4R)-7-(4-isocyanonaphthalen-1-yl)oxy-3,4-dihydro-2H-chromen-4-yl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-hydroxy-5-[(4R)-7-(4-isocyanonaphthalen-1-yl)oxy-3,4-dihydro-2H-chromen-4-yl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 91586243 |
| Molecular Formula | C23H16N2O4S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | 4-hydroxy-5-[(4R)-7-(4-isocyanonaphthalen-1-yl)oxy-3,4-dihydro-2H-chromen-4-yl]-3H-1,3-thiazol-2-one |
| SMILES | [C-]#[N+]c1ccc(Oc2ccc3c(c2)OCC[C@H]3c2sc(=O)[nH]c2O)c2ccccc12 |
| InChI | InChI=1S/C23H16N2O4S/c1-24-18-8-9-19(15-5-3-2-4-14(15)18)29-13-6-7-16-17(10-11-28-20(16)12-13)21-22(26)25-23(27)30-21/h2-9,12,17,26H,10-11H2,(H,25,27)/t17-/m1/s1 |
| InChIKey | MYDFKOKKHSGJBS-QGZVFWFLSA-N |
| XLogP | 5.55 |
| TPSA | 75.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|