C35H59O4PSi3 — CID 91586432
[(2R,6R)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-4-(2-diphenylphosphorylethyl)cyclohex-3-en-1-yl]oxy-trimethylsilane (PubChem CID 91586432) has the molecular formula C35H59O4PSi3 and a molecular weight of 659.09 g/mol. Its IUPAC name is [(2R,6R)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-4-(2-diphenylphosphorylethyl)cyclohex-3-en-1-yl]oxy-trimethylsilane.
| Compound Name | [(2R,6R)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-4-(2-diphenylphosphorylethyl)cyclohex-3-en-1-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 91586432 |
| Molecular Formula | C35H59O4PSi3 |
| Molecular Weight | 659.09 g/mol |
| Exact Mass | 658.35 |
| IUPAC Name | [(2R,6R)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-4-(2-diphenylphosphorylethyl)cyclohex-3-en-1-yl]oxy-trimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C=C(CCP(=O)(c2ccccc2)c2ccccc2)C[C@@H](O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C |
| InChI | InChI=1S/C35H59O4PSi3/c1-34(2,3)42(10,11)37-31-26-28(27-32(33(31)39-41(7,8)9)38-43(12,13)35(4,5)6)24-25-40(36,29-20-16-14-17-21-29)30-22-18-15-19-23-30/h14-23,26,31-33H,24-25,27H2,1-13H3/t31-,32-,33?/m1/s1 |
| InChIKey | RYXSWZUCIZTEIN-NWBPNMJXSA-N |
| XLogP | 9.72 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.09 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|