C35H43N3O9 — CID 91586445
[(8S,9S,12S,13R,14S)-19-benzamido-13,20,22-trihydroxy-8,14-dimethoxy-4,10,12,16-tetramethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,16,18(22),19-heptaen-9-yl] carbamate (PubChem CID 91586445) has the molecular formula C35H43N3O9 and a molecular weight of 649.74 g/mol. Its IUPAC name is [(8S,9S,12S,13R,14S)-19-benzamido-13,20,22-trihydroxy-8,14-dimethoxy-4,10,12,16-tetramethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,16,18(22),19-heptaen-9-yl] carbamate.
| Compound Name | [(8S,9S,12S,13R,14S)-19-benzamido-13,20,22-trihydroxy-8,14-dimethoxy-4,10,12,16-tetramethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,16,18(22),19-heptaen-9-yl] carbamate |
|---|---|
| PubChem CID | 91586445 |
| Molecular Formula | C35H43N3O9 |
| Molecular Weight | 649.74 g/mol |
| Exact Mass | 649.30 |
| IUPAC Name | [(8S,9S,12S,13R,14S)-19-benzamido-13,20,22-trihydroxy-8,14-dimethoxy-4,10,12,16-tetramethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,16,18(22),19-heptaen-9-yl] carbamate |
| SMILES | CO[C@H]1C=CC=C(C)C(=O)Nc2cc(O)c(NC(=O)c3ccccc3)c(c2O)C=C(C)C[C@H](OC)[C@H](O)[C@@H](C)C=C(C)[C@@H]1OC(N)=O |
| InChI | InChI=1S/C35H43N3O9/c1-19-15-24-29(38-34(43)23-12-8-7-9-13-23)26(39)18-25(31(24)41)37-33(42)20(2)11-10-14-27(45-5)32(47-35(36)44)22(4)17-21(3)30(40)28(16-19)46-6/h7-15,17-18,21,27-28,30,32,39-41H,16H2,1-6H3,(H2,36,44)(H,37,42)(H,38,43)/t21-,27-,28-,30+,32-/m0/s1 |
| InChIKey | HHVRUGSJLYEZRB-DDSDXLKZSA-N |
| XLogP | 5.04 |
| TPSA | 189.67 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.74 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|