C13H16O3 — CID 91586591
(6aR)-6a-hydroxy-4,4a,6,7,10a,10b-hexahydro-1H-benzo[c]chromen-8-one (PubChem CID 91586591) has the molecular formula C13H16O3 and a molecular weight of 220.27 g/mol. Its IUPAC name is (6aR)-6a-hydroxy-4,4a,6,7,10a,10b-hexahydro-1H-benzo[c]chromen-8-one.
| Compound Name | (6aR)-6a-hydroxy-4,4a,6,7,10a,10b-hexahydro-1H-benzo[c]chromen-8-one |
|---|---|
| PubChem CID | 91586591 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | (6aR)-6a-hydroxy-4,4a,6,7,10a,10b-hexahydro-1H-benzo[c]chromen-8-one |
| SMILES | O=C1C=CC2C3CC=CCC3OC[C@@]2(O)C1 |
| InChI | InChI=1S/C13H16O3/c14-9-5-6-11-10-3-1-2-4-12(10)16-8-13(11,15)7-9/h1-2,5-6,10-12,15H,3-4,7-8H2/t10?,11?,12?,13-/m0/s1 |
| InChIKey | RBRGAFAIVWGBLV-SKQCGHHBSA-N |
| XLogP | 1.23 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|