C31H60O4Si2 — CID 91587052
tert-butyl-[(1R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[7-[(2R)-oxan-2-yl]oxyoct-2-enylidene]cyclohexyl]oxy-dimethylsilane (PubChem CID 91587052) has the molecular formula C31H60O4Si2 and a molecular weight of 552.99 g/mol. Its IUPAC name is tert-butyl-[(1R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[7-[(2R)-oxan-2-yl]oxyoct-2-enylidene]cyclohexyl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[7-[(2R)-oxan-2-yl]oxyoct-2-enylidene]cyclohexyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 91587052 |
| Molecular Formula | C31H60O4Si2 |
| Molecular Weight | 552.99 g/mol |
| Exact Mass | 552.40 |
| IUPAC Name | tert-butyl-[(1R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[7-[(2R)-oxan-2-yl]oxyoct-2-enylidene]cyclohexyl]oxy-dimethylsilane |
| SMILES | CC(CCCC=CC=C1C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H](O[Si](C)(C)C(C)(C)C)C1)O[C@@H]1CCCCO1 |
| InChI | InChI=1S/C31H60O4Si2/c1-25(33-29-20-16-17-21-32-29)18-14-12-13-15-19-26-22-27(34-36(8,9)30(2,3)4)24-28(23-26)35-37(10,11)31(5,6)7/h13,15,19,25,27-29H,12,14,16-18,20-24H2,1-11H3/t25?,27-,28-,29-/m1/s1 |
| InChIKey | HMBSBAQWVUVLIU-VZXWBTEVSA-N |
| XLogP | 9.54 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.99 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|