C10H10FNO — CID 91587883
3-(4-fluorophenyl)-5-methyl-2,5-dihydro-1,2-oxazole (PubChem CID 91587883) has the molecular formula C10H10FNO and a molecular weight of 179.19 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-5-methyl-2,5-dihydro-1,2-oxazole.
| Compound Name | 3-(4-fluorophenyl)-5-methyl-2,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 91587883 |
| Molecular Formula | C10H10FNO |
| Molecular Weight | 179.19 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 3-(4-fluorophenyl)-5-methyl-2,5-dihydro-1,2-oxazole |
| SMILES | CC1C=C(c2ccc(F)cc2)NO1 |
| InChI | InChI=1S/C10H10FNO/c1-7-6-10(12-13-7)8-2-4-9(11)5-3-8/h2-7,12H,1H3 |
| InChIKey | SPIIDQGECXUGFI-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.19 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |