C9H13F5S — CID 91587955
3-ethyl-1-ethylsulfanyl-4,4,5,5,5-pentafluoropent-2-ene (PubChem CID 91587955) has the molecular formula C9H13F5S and a molecular weight of 248.26 g/mol. Its IUPAC name is 3-ethyl-1-ethylsulfanyl-4,4,5,5,5-pentafluoropent-2-ene.
| Compound Name | 3-ethyl-1-ethylsulfanyl-4,4,5,5,5-pentafluoropent-2-ene |
|---|---|
| PubChem CID | 91587955 |
| Molecular Formula | C9H13F5S |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 3-ethyl-1-ethylsulfanyl-4,4,5,5,5-pentafluoropent-2-ene |
| SMILES | CCSCC=C(CC)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H13F5S/c1-3-7(5-6-15-4-2)8(10,11)9(12,13)14/h5H,3-4,6H2,1-2H3 |
| InChIKey | YFUFBUVEHGYZGR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|