C20H31BrO7 — CID 91588133
methyl 2-[(2S,4R,6R)-6-[(1R,6R)-9-bromo-1-hydroxy-6-methoxy-3-methylnona-2,4,8-trienyl]-2-hydroxy-4-methoxyoxan-2-yl]acetate (PubChem CID 91588133) has the molecular formula C20H31BrO7 and a molecular weight of 463.37 g/mol. Its IUPAC name is methyl 2-[(2S,4R,6R)-6-[(1R,6R)-9-bromo-1-hydroxy-6-methoxy-3-methylnona-2,4,8-trienyl]-2-hydroxy-4-methoxyoxan-2-yl]acetate.
| Compound Name | methyl 2-[(2S,4R,6R)-6-[(1R,6R)-9-bromo-1-hydroxy-6-methoxy-3-methylnona-2,4,8-trienyl]-2-hydroxy-4-methoxyoxan-2-yl]acetate |
|---|---|
| PubChem CID | 91588133 |
| Molecular Formula | C20H31BrO7 |
| Molecular Weight | 463.37 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | methyl 2-[(2S,4R,6R)-6-[(1R,6R)-9-bromo-1-hydroxy-6-methoxy-3-methylnona-2,4,8-trienyl]-2-hydroxy-4-methoxyoxan-2-yl]acetate |
| SMILES | COC(=O)C[C@]1(O)C[C@H](OC)C[C@H]([C@H](O)C=C(C)C=C[C@@H](CC=CBr)OC)O1 |
| InChI | InChI=1S/C20H31BrO7/c1-14(7-8-15(25-2)6-5-9-21)10-17(22)18-11-16(26-3)12-20(24,28-18)13-19(23)27-4/h5,7-10,15-18,22,24H,6,11-13H2,1-4H3/t15-,16-,17-,18-,20+/m1/s1 |
| InChIKey | LZVIIFZELQIKJA-VBEQINLCSA-N |
| XLogP | 2.61 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.37 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|