C21H22NO4+ — CID 91588565
16,17-dimethoxy-17-methyl-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,18,20-heptaene (PubChem CID 91588565) has the molecular formula C21H22NO4+ and a molecular weight of 352.41 g/mol. Its IUPAC name is 16,17-dimethoxy-17-methyl-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,18,20-heptaene.
| Compound Name | 16,17-dimethoxy-17-methyl-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,18,20-heptaene |
|---|---|
| PubChem CID | 91588565 |
| Molecular Formula | C21H22NO4+ |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 16,17-dimethoxy-17-methyl-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,18,20-heptaene |
| SMILES | COC1c2c[n+]3c(cc2C=CC1(C)OC)-c1cc2c(cc1CC3)OCO2 |
| InChI | InChI=1S/C21H22NO4/c1-21(24-3)6-4-13-8-17-15-10-19-18(25-12-26-19)9-14(15)5-7-22(17)11-16(13)20(21)23-2/h4,6,8-11,20H,5,7,12H2,1-3H3/q+1 |
| InChIKey | RHLRBSYSJKXVMS-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 40.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|