About (2R)-2-amino-1-(2,3-dihydroxy-5-methylphenyl)-3-sulfanylpropan-1-one
(2R)-2-amino-1-(2,3-dihydroxy-5-methylphenyl)-3-sulfanylpropan-1-one (PubChem CID 91588676) has the molecular formula C10H13NO3S
and a molecular weight of 227.28 g/mol. Its IUPAC name is (2R)-2-amino-1-(2,3-dihydroxy-5-methylphenyl)-3-sulfanylpropan-1-one.
Molecular Properties
| Compound Name | (2R)-2-amino-1-(2,3-dihydroxy-5-methylphenyl)-3-sulfanylpropan-1-one |
| PubChem CID | 91588676 |
| Molecular Formula | C10H13NO3S |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | (2R)-2-amino-1-(2,3-dihydroxy-5-methylphenyl)-3-sulfanylpropan-1-one |
| SMILES | Cc1cc(O)c(O)c(C(=O)[C@@H](N)CS)c1 |
| InChI | InChI=1S/C10H13NO3S/c1-5-2-6(9(13)7(11)4-15)10(14)8(12)3-5/h2-3,7,12,14-15H,4,11H2,1H3/t7-/m0/s1 |
| InChIKey | OJDQOBKVSJUAEW-ZETCQYMHSA-N |
| XLogP | 0.85 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-amino-1-(2,3-dihydroxy-5-methylphenyl)-3-sulfanylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-amino-1-(2,3-dihydroxy-5-methylphenyl)-3-sulfanylpropan-1-one?
The IUPAC name of (2R)-2-amino-1-(2,3-dihydroxy-5-methylphenyl)-3-sulfanylpropan-1-one (CID 91588676) is (2R)-2-amino-1-(2,3-dihydroxy-5-methylphenyl)-3-sulfanylpropan-1-one.
What is the SMILES notation for (2R)-2-amino-1-(2,3-dihydroxy-5-methylphenyl)-3-sulfanylpropan-1-one?
The canonical SMILES for (2R)-2-amino-1-(2,3-dihydroxy-5-methylphenyl)-3-sulfanylpropan-1-one is Cc1cc(O)c(O)c(C(=O)[C@@H](N)CS)c1.
What is the InChIKey of (2R)-2-amino-1-(2,3-dihydroxy-5-methylphenyl)-3-sulfanylpropan-1-one?
The InChIKey is OJDQOBKVSJUAEW-ZETCQYMHSA-N. The full InChI is InChI=1S/C10H13NO3S/c1-5-2-6(9(13)7(11)4-15)10(14)8(12)3-5/h2-3,7,12,14-15H,4,11H2,1H3/t7-/m0/s1.
What are the key properties of (2R)-2-amino-1-(2,3-dihydroxy-5-methylphenyl)-3-sulfanylpropan-1-one?
(2R)-2-amino-1-(2,3-dihydroxy-5-methylphenyl)-3-sulfanylpropan-1-one has a molecular weight of 227.28 g/mol, XLogP of 0.85, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-1-(2,3-dihydroxy-5-methylphenyl)-3-sulfanylpropan-1-one is sourced from PubChem (CID 91588676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).