C17H21ClN4O — CID 91588865
7-chloro-5-(2-ethoxyphenyl)-1-methyl-3-propyl-4,7-dihydropyrazolo[4,5-d]pyrimidine (PubChem CID 91588865) has the molecular formula C17H21ClN4O and a molecular weight of 332.84 g/mol. Its IUPAC name is 7-chloro-5-(2-ethoxyphenyl)-1-methyl-3-propyl-4,7-dihydropyrazolo[4,5-d]pyrimidine.
| Compound Name | 7-chloro-5-(2-ethoxyphenyl)-1-methyl-3-propyl-4,7-dihydropyrazolo[4,5-d]pyrimidine |
|---|---|
| PubChem CID | 91588865 |
| Molecular Formula | C17H21ClN4O |
| Molecular Weight | 332.84 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 7-chloro-5-(2-ethoxyphenyl)-1-methyl-3-propyl-4,7-dihydropyrazolo[4,5-d]pyrimidine |
| SMILES | CCCc1nn(C)c2c1NC(c1ccccc1OCC)=NC2Cl |
| InChI | InChI=1S/C17H21ClN4O/c1-4-8-12-14-15(22(3)21-12)16(18)20-17(19-14)11-9-6-7-10-13(11)23-5-2/h6-7,9-10,16H,4-5,8H2,1-3H3,(H,19,20) |
| InChIKey | QVWCBESFRVLQSM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 51.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.84 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|