C30H25F3N4O4 — CID 91588963
(2R,3S)-3-(4,6-dimethoxypyrimidin-2-yl)oxy-2-phenyl-8-[(2,4,6-trifluorophenyl)methyl]-5,8-diazatricyclo[7.4.0.02,5]trideca-1(13),9,11-trien-4-one (PubChem CID 91588963) has the molecular formula C30H25F3N4O4 and a molecular weight of 562.55 g/mol. Its IUPAC name is (2R,3S)-3-(4,6-dimethoxypyrimidin-2-yl)oxy-2-phenyl-8-[(2,4,6-trifluorophenyl)methyl]-5,8-diazatricyclo[7.4.0.02,5]trideca-1(13),9,11-trien-4-one.
| Compound Name | (2R,3S)-3-(4,6-dimethoxypyrimidin-2-yl)oxy-2-phenyl-8-[(2,4,6-trifluorophenyl)methyl]-5,8-diazatricyclo[7.4.0.02,5]trideca-1(13),9,11-trien-4-one |
|---|---|
| PubChem CID | 91588963 |
| Molecular Formula | C30H25F3N4O4 |
| Molecular Weight | 562.55 g/mol |
| Exact Mass | 562.18 |
| IUPAC Name | (2R,3S)-3-(4,6-dimethoxypyrimidin-2-yl)oxy-2-phenyl-8-[(2,4,6-trifluorophenyl)methyl]-5,8-diazatricyclo[7.4.0.02,5]trideca-1(13),9,11-trien-4-one |
| SMILES | COc1cc(OC)nc(O[C@@H]2C(=O)N3CCN(Cc4c(F)cc(F)cc4F)c4ccccc4[C@]23c2ccccc2)n1 |
| InChI | InChI=1S/C30H25F3N4O4/c1-39-25-16-26(40-2)35-29(34-25)41-27-28(38)37-13-12-36(17-20-22(32)14-19(31)15-23(20)33)24-11-7-6-10-21(24)30(27,37)18-8-4-3-5-9-18/h3-11,14-16,27H,12-13,17H2,1-2H3/t27-,30-/m1/s1 |
| InChIKey | DDSAQPCZSKLYSW-POURPWNDSA-N |
| XLogP | 4.46 |
| TPSA | 77.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.55 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |