C23H22BrN7O4S2 — CID 91589009
5-(4-bromophenyl)-4-[[methyl(pyridin-4-yl)sulfamoyl]amino]-6-[2-(5-methylsulfanylpyrimidin-2-yl)oxyethoxy]pyrimidine (PubChem CID 91589009) has the molecular formula C23H22BrN7O4S2 and a molecular weight of 604.51 g/mol. Its IUPAC name is 5-(4-bromophenyl)-4-[[methyl(pyridin-4-yl)sulfamoyl]amino]-6-[2-(5-methylsulfanylpyrimidin-2-yl)oxyethoxy]pyrimidine.
| Compound Name | 5-(4-bromophenyl)-4-[[methyl(pyridin-4-yl)sulfamoyl]amino]-6-[2-(5-methylsulfanylpyrimidin-2-yl)oxyethoxy]pyrimidine |
|---|---|
| PubChem CID | 91589009 |
| Molecular Formula | C23H22BrN7O4S2 |
| Molecular Weight | 604.51 g/mol |
| Exact Mass | 603.04 |
| IUPAC Name | 5-(4-bromophenyl)-4-[[methyl(pyridin-4-yl)sulfamoyl]amino]-6-[2-(5-methylsulfanylpyrimidin-2-yl)oxyethoxy]pyrimidine |
| SMILES | CSc1cnc(OCCOc2ncnc(NS(=O)(=O)N(C)c3ccncc3)c2-c2ccc(Br)cc2)nc1 |
| InChI | InChI=1S/C23H22BrN7O4S2/c1-31(18-7-9-25-10-8-18)37(32,33)30-21-20(16-3-5-17(24)6-4-16)22(29-15-28-21)34-11-12-35-23-26-13-19(36-2)14-27-23/h3-10,13-15H,11-12H2,1-2H3,(H,28,29,30) |
| InChIKey | BHPAWJNRRKCLGK-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 132.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|