About 4-ethyl-1,2-dimethyl-2H-pyrimidine
4-ethyl-1,2-dimethyl-2H-pyrimidine (PubChem CID 91589403) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is 4-ethyl-1,2-dimethyl-2H-pyrimidine.
Molecular Properties
| Compound Name | 4-ethyl-1,2-dimethyl-2H-pyrimidine |
| PubChem CID | 91589403 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 4-ethyl-1,2-dimethyl-2H-pyrimidine |
| SMILES | CCC1=NC(C)N(C)C=C1 |
| InChI | InChI=1S/C8H14N2/c1-4-8-5-6-10(3)7(2)9-8/h5-7H,4H2,1-3H3 |
| InChIKey | YHDOLCUHWMJMRC-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethyl-1,2-dimethyl-2H-pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-1,2-dimethyl-2H-pyrimidine?
The IUPAC name of 4-ethyl-1,2-dimethyl-2H-pyrimidine (CID 91589403) is 4-ethyl-1,2-dimethyl-2H-pyrimidine.
What is the SMILES notation for 4-ethyl-1,2-dimethyl-2H-pyrimidine?
The canonical SMILES for 4-ethyl-1,2-dimethyl-2H-pyrimidine is CCC1=NC(C)N(C)C=C1.
What is the InChIKey of 4-ethyl-1,2-dimethyl-2H-pyrimidine?
The InChIKey is YHDOLCUHWMJMRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2/c1-4-8-5-6-10(3)7(2)9-8/h5-7H,4H2,1-3H3.
What are the key properties of 4-ethyl-1,2-dimethyl-2H-pyrimidine?
4-ethyl-1,2-dimethyl-2H-pyrimidine has a molecular weight of 138.21 g/mol, XLogP of 1.64, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-1,2-dimethyl-2H-pyrimidine is sourced from PubChem (CID 91589403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).