C24H22BrFN6O4S2 — CID 91589579
5-(4-bromophenyl)-N-[(4-fluorophenyl)methylsulfamoyl]-6-[2-(5-methylsulfanylpyrimidin-2-yl)oxyethoxy]pyrimidin-4-amine (PubChem CID 91589579) has the molecular formula C24H22BrFN6O4S2 and a molecular weight of 621.51 g/mol. Its IUPAC name is 5-(4-bromophenyl)-N-[(4-fluorophenyl)methylsulfamoyl]-6-[2-(5-methylsulfanylpyrimidin-2-yl)oxyethoxy]pyrimidin-4-amine.
| Compound Name | 5-(4-bromophenyl)-N-[(4-fluorophenyl)methylsulfamoyl]-6-[2-(5-methylsulfanylpyrimidin-2-yl)oxyethoxy]pyrimidin-4-amine |
|---|---|
| PubChem CID | 91589579 |
| Molecular Formula | C24H22BrFN6O4S2 |
| Molecular Weight | 621.51 g/mol |
| Exact Mass | 620.03 |
| IUPAC Name | 5-(4-bromophenyl)-N-[(4-fluorophenyl)methylsulfamoyl]-6-[2-(5-methylsulfanylpyrimidin-2-yl)oxyethoxy]pyrimidin-4-amine |
| SMILES | CSc1cnc(OCCOc2ncnc(NS(=O)(=O)NCc3ccc(F)cc3)c2-c2ccc(Br)cc2)nc1 |
| InChI | InChI=1S/C24H22BrFN6O4S2/c1-37-20-13-27-24(28-14-20)36-11-10-35-23-21(17-4-6-18(25)7-5-17)22(29-15-30-23)32-38(33,34)31-12-16-2-8-19(26)9-3-16/h2-9,13-15,31H,10-12H2,1H3,(H,29,30,32) |
| InChIKey | XCXIAHYBXGRHSR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.51 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|