About 2,3-dimethyl-1-phenyl-2,3-dihydroquinolin-4-one;ethane
2,3-dimethyl-1-phenyl-2,3-dihydroquinolin-4-one;ethane (PubChem CID 91590341) has the molecular formula C23H35NO
and a molecular weight of 341.54 g/mol. Its IUPAC name is 2,3-dimethyl-1-phenyl-2,3-dihydroquinolin-4-one;ethane.
Molecular Properties
| Compound Name | 2,3-dimethyl-1-phenyl-2,3-dihydroquinolin-4-one;ethane |
| PubChem CID | 91590341 |
| Molecular Formula | C23H35NO |
| Molecular Weight | 341.54 g/mol |
| Exact Mass | 341.27 |
| IUPAC Name | 2,3-dimethyl-1-phenyl-2,3-dihydroquinolin-4-one;ethane |
| SMILES | CC.CC.CC.CC1C(=O)c2ccccc2N(c2ccccc2)C1C |
| InChI | InChI=1S/C17H17NO.3C2H6/c1-12-13(2)18(14-8-4-3-5-9-14)16-11-7-6-10-15(16)17(12)19;3*1-2/h3-13H,1-2H3;3*1-2H3 |
| InChIKey | CBDJWGOMLDKGGI-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.54 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-dimethyl-1-phenyl-2,3-dihydroquinolin-4-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-1-phenyl-2,3-dihydroquinolin-4-one;ethane?
The IUPAC name of 2,3-dimethyl-1-phenyl-2,3-dihydroquinolin-4-one;ethane (CID 91590341) is 2,3-dimethyl-1-phenyl-2,3-dihydroquinolin-4-one;ethane.
What is the SMILES notation for 2,3-dimethyl-1-phenyl-2,3-dihydroquinolin-4-one;ethane?
The canonical SMILES for 2,3-dimethyl-1-phenyl-2,3-dihydroquinolin-4-one;ethane is CC.CC.CC.CC1C(=O)c2ccccc2N(c2ccccc2)C1C.
What is the InChIKey of 2,3-dimethyl-1-phenyl-2,3-dihydroquinolin-4-one;ethane?
The InChIKey is CBDJWGOMLDKGGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NO.3C2H6/c1-12-13(2)18(14-8-4-3-5-9-14)16-11-7-6-10-15(16)17(12)19;3*1-2/h3-13H,1-2H3;3*1-2H3.
What are the key properties of 2,3-dimethyl-1-phenyl-2,3-dihydroquinolin-4-one;ethane?
2,3-dimethyl-1-phenyl-2,3-dihydroquinolin-4-one;ethane has a molecular weight of 341.54 g/mol, XLogP of 7.12, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-1-phenyl-2,3-dihydroquinolin-4-one;ethane is sourced from PubChem (CID 91590341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).