C42H50BN4+ — CID 91590496
14-(2,6-dimethylphenyl)-8,9-diethyl-8-methyl-9-[1-[1-methyl-3-(2-methylphenyl)-2H-benzimidazol-2-yl]propan-2-yl]-1-aza-7-azonia-14-boratricyclo[8.4.0.02,7]tetradeca-2,4,6,10,12-pentaene (PubChem CID 91590496) has the molecular formula C42H50BN4+ and a molecular weight of 621.70 g/mol. Its IUPAC name is 14-(2,6-dimethylphenyl)-8,9-diethyl-8-methyl-9-[1-[1-methyl-3-(2-methylphenyl)-2H-benzimidazol-2-yl]propan-2-yl]-1-aza-7-azonia-14-boratricyclo[8.4.0.02,7]tetradeca-2,4,6,10,12-pentaene.
| Compound Name | 14-(2,6-dimethylphenyl)-8,9-diethyl-8-methyl-9-[1-[1-methyl-3-(2-methylphenyl)-2H-benzimidazol-2-yl]propan-2-yl]-1-aza-7-azonia-14-boratricyclo[8.4.0.02,7]tetradeca-2,4,6,10,12-pentaene |
|---|---|
| PubChem CID | 91590496 |
| Molecular Formula | C42H50BN4+ |
| Molecular Weight | 621.70 g/mol |
| Exact Mass | 621.41 |
| IUPAC Name | 14-(2,6-dimethylphenyl)-8,9-diethyl-8-methyl-9-[1-[1-methyl-3-(2-methylphenyl)-2H-benzimidazol-2-yl]propan-2-yl]-1-aza-7-azonia-14-boratricyclo[8.4.0.02,7]tetradeca-2,4,6,10,12-pentaene |
| SMILES | CCC1(C(C)CC2N(C)c3ccccc3N2c2ccccc2C)C2=CC=CB(c3c(C)cccc3C)N2c2cccc[n+]2C1(C)CC |
| InChI | InChI=1S/C42H50BN4/c1-9-41(7)42(10-2,33(6)29-39-44(8)35-23-13-14-24-36(35)46(39)34-22-12-11-19-30(34)3)37-25-18-27-43(40-31(4)20-17-21-32(40)5)47(37)38-26-15-16-28-45(38)41/h11-28,33,39H,9-10,29H2,1-8H3/q+1 |
| InChIKey | WIPKUMZOGFNDKT-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 13.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.70 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|