C12H19NO2 — CID 91590572
2-[(E)-N-hydroxy-C-methylcarbonimidoyl]-3,4,6,6-tetramethylcyclohex-2-en-1-one (PubChem CID 91590572) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is 2-[(E)-N-hydroxy-C-methylcarbonimidoyl]-3,4,6,6-tetramethylcyclohex-2-en-1-one.
| Compound Name | 2-[(E)-N-hydroxy-C-methylcarbonimidoyl]-3,4,6,6-tetramethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 91590572 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 2-[(E)-N-hydroxy-C-methylcarbonimidoyl]-3,4,6,6-tetramethylcyclohex-2-en-1-one |
| SMILES | CC1=C(/C(C)=N/O)C(=O)C(C)(C)CC1C |
| InChI | InChI=1S/C12H19NO2/c1-7-6-12(4,5)11(14)10(8(7)2)9(3)13-15/h7,15H,6H2,1-5H3/b13-9+ |
| InChIKey | XHBVSOJBYUOEEV-UKTHLTGXSA-N |
| XLogP | 2.79 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|