C55H42O2Si — CID 91590613
10,10-dimethyl-7-(4-methylnaphthalen-1-yl)-17-naphthalen-1-yl-14,21-diphenyl-10-silapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4(9),5,7,11,15(20),16,18-nonaene-14,21-diol (PubChem CID 91590613) has the molecular formula C55H42O2Si and a molecular weight of 763.03 g/mol. Its IUPAC name is 10,10-dimethyl-7-(4-methylnaphthalen-1-yl)-17-naphthalen-1-yl-14,21-diphenyl-10-silapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4(9),5,7,11,15(20),16,18-nonaene-14,21-diol.
| Compound Name | 10,10-dimethyl-7-(4-methylnaphthalen-1-yl)-17-naphthalen-1-yl-14,21-diphenyl-10-silapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4(9),5,7,11,15(20),16,18-nonaene-14,21-diol |
|---|---|
| PubChem CID | 91590613 |
| Molecular Formula | C55H42O2Si |
| Molecular Weight | 763.03 g/mol |
| Exact Mass | 762.30 |
| IUPAC Name | 10,10-dimethyl-7-(4-methylnaphthalen-1-yl)-17-naphthalen-1-yl-14,21-diphenyl-10-silapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4(9),5,7,11,15(20),16,18-nonaene-14,21-diol |
| SMILES | Cc1ccc(-c2ccc3c(c2)[Si](C)(C)c2cc4c(cc2-3)C(O)(c2ccccc2)c2ccc(-c3cccc5ccccc35)cc2C4(O)c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C55H42O2Si/c1-35-25-28-44(45-23-13-12-21-41(35)45)38-26-29-46-47-33-50-51(34-53(47)58(2,3)52(46)32-38)55(57,40-19-8-5-9-20-40)49-31-37(43-24-14-16-36-15-10-11-22-42(36)43)27-30-48(49)54(50,56)39-17-6-4-7-18-39/h4-34,56-57H,1-3H3 |
| InChIKey | BBVFBBJYMPNNOM-UHFFFAOYSA-N |
| XLogP | 11.32 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.03 |
| LogP ≤ 5 | 11.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|