C24H26FNO2 — CID 91590643
5-[2-(4-fluorophenyl)ethenyl]-8-hexyl-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinoline (PubChem CID 91590643) has the molecular formula C24H26FNO2 and a molecular weight of 379.48 g/mol. Its IUPAC name is 5-[2-(4-fluorophenyl)ethenyl]-8-hexyl-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinoline.
| Compound Name | 5-[2-(4-fluorophenyl)ethenyl]-8-hexyl-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinoline |
|---|---|
| PubChem CID | 91590643 |
| Molecular Formula | C24H26FNO2 |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 5-[2-(4-fluorophenyl)ethenyl]-8-hexyl-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinoline |
| SMILES | CCCCCCC1CN=C(C=Cc2ccc(F)cc2)c2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C24H26FNO2/c1-2-3-4-5-6-18-15-26-22(12-9-17-7-10-19(25)11-8-17)21-14-24-23(13-20(18)21)27-16-28-24/h7-14,18H,2-6,15-16H2,1H3 |
| InChIKey | DCHJCIRPDFOQHK-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|