About [4-(1,3-oxazol-5-yl)phenyl]-(1,3-thiazol-2-ylmethyl)diazene
[4-(1,3-oxazol-5-yl)phenyl]-(1,3-thiazol-2-ylmethyl)diazene (PubChem CID 91590739) has the molecular formula C13H10N4OS
and a molecular weight of 270.32 g/mol. Its IUPAC name is [4-(1,3-oxazol-5-yl)phenyl]-(1,3-thiazol-2-ylmethyl)diazene.
Molecular Properties
| Compound Name | [4-(1,3-oxazol-5-yl)phenyl]-(1,3-thiazol-2-ylmethyl)diazene |
| PubChem CID | 91590739 |
| Molecular Formula | C13H10N4OS |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | [4-(1,3-oxazol-5-yl)phenyl]-(1,3-thiazol-2-ylmethyl)diazene |
| SMILES | c1csc(C/N=N/c2ccc(-c3cnco3)cc2)n1 |
| InChI | InChI=1S/C13H10N4OS/c1-3-11(17-16-8-13-15-5-6-19-13)4-2-10(1)12-7-14-9-18-12/h1-7,9H,8H2/b17-16+ |
| InChIKey | DMAZQCWGJCBODX-WUKNDPDISA-N |
| XLogP | 4.08 |
| TPSA | 63.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze [4-(1,3-oxazol-5-yl)phenyl]-(1,3-thiazol-2-ylmethyl)diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(1,3-oxazol-5-yl)phenyl]-(1,3-thiazol-2-ylmethyl)diazene?
The IUPAC name of [4-(1,3-oxazol-5-yl)phenyl]-(1,3-thiazol-2-ylmethyl)diazene (CID 91590739) is [4-(1,3-oxazol-5-yl)phenyl]-(1,3-thiazol-2-ylmethyl)diazene.
What is the SMILES notation for [4-(1,3-oxazol-5-yl)phenyl]-(1,3-thiazol-2-ylmethyl)diazene?
The canonical SMILES for [4-(1,3-oxazol-5-yl)phenyl]-(1,3-thiazol-2-ylmethyl)diazene is c1csc(C/N=N/c2ccc(-c3cnco3)cc2)n1.
What is the InChIKey of [4-(1,3-oxazol-5-yl)phenyl]-(1,3-thiazol-2-ylmethyl)diazene?
The InChIKey is DMAZQCWGJCBODX-WUKNDPDISA-N. The full InChI is InChI=1S/C13H10N4OS/c1-3-11(17-16-8-13-15-5-6-19-13)4-2-10(1)12-7-14-9-18-12/h1-7,9H,8H2/b17-16+.
What are the key properties of [4-(1,3-oxazol-5-yl)phenyl]-(1,3-thiazol-2-ylmethyl)diazene?
[4-(1,3-oxazol-5-yl)phenyl]-(1,3-thiazol-2-ylmethyl)diazene has a molecular weight of 270.32 g/mol, XLogP of 4.08, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1,3-oxazol-5-yl)phenyl]-(1,3-thiazol-2-ylmethyl)diazene is sourced from PubChem (CID 91590739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).