About (2,6-dichlorocyclohexa-2,4-dien-1-yl)-trimethylsilylmethanimine
(2,6-dichlorocyclohexa-2,4-dien-1-yl)-trimethylsilylmethanimine (PubChem CID 91591121) has the molecular formula C10H15Cl2NSi
and a molecular weight of 248.23 g/mol. Its IUPAC name is (2,6-dichlorocyclohexa-2,4-dien-1-yl)-trimethylsilylmethanimine.
Molecular Properties
| Compound Name | (2,6-dichlorocyclohexa-2,4-dien-1-yl)-trimethylsilylmethanimine |
| PubChem CID | 91591121 |
| Molecular Formula | C10H15Cl2NSi |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | (2,6-dichlorocyclohexa-2,4-dien-1-yl)-trimethylsilylmethanimine |
| SMILES | [H]/N=C(/C1C(Cl)=CC=CC1Cl)[Si](C)(C)C |
| InChI | InChI=1S/C10H15Cl2NSi/c1-14(2,3)10(13)9-7(11)5-4-6-8(9)12/h4-7,9,13H,1-3H3/b13-10- |
| InChIKey | OFURETNURXMNNR-RAXLEYEMSA-N |
| XLogP | 3.80 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (2,6-dichlorocyclohexa-2,4-dien-1-yl)-trimethylsilylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,6-dichlorocyclohexa-2,4-dien-1-yl)-trimethylsilylmethanimine?
The IUPAC name of (2,6-dichlorocyclohexa-2,4-dien-1-yl)-trimethylsilylmethanimine (CID 91591121) is (2,6-dichlorocyclohexa-2,4-dien-1-yl)-trimethylsilylmethanimine.
What is the SMILES notation for (2,6-dichlorocyclohexa-2,4-dien-1-yl)-trimethylsilylmethanimine?
The canonical SMILES for (2,6-dichlorocyclohexa-2,4-dien-1-yl)-trimethylsilylmethanimine is [H]/N=C(/C1C(Cl)=CC=CC1Cl)[Si](C)(C)C.
What is the InChIKey of (2,6-dichlorocyclohexa-2,4-dien-1-yl)-trimethylsilylmethanimine?
The InChIKey is OFURETNURXMNNR-RAXLEYEMSA-N. The full InChI is InChI=1S/C10H15Cl2NSi/c1-14(2,3)10(13)9-7(11)5-4-6-8(9)12/h4-7,9,13H,1-3H3/b13-10-.
What are the key properties of (2,6-dichlorocyclohexa-2,4-dien-1-yl)-trimethylsilylmethanimine?
(2,6-dichlorocyclohexa-2,4-dien-1-yl)-trimethylsilylmethanimine has a molecular weight of 248.23 g/mol, XLogP of 3.80, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-dichlorocyclohexa-2,4-dien-1-yl)-trimethylsilylmethanimine is sourced from PubChem (CID 91591121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).