C14H24O2 — CID 91591502
1,1,2,3,3-pentamethyl-2,5,6,7-tetrahydroindene-4,4-diol (PubChem CID 91591502) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is 1,1,2,3,3-pentamethyl-2,5,6,7-tetrahydroindene-4,4-diol.
| Compound Name | 1,1,2,3,3-pentamethyl-2,5,6,7-tetrahydroindene-4,4-diol |
|---|---|
| PubChem CID | 91591502 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | 1,1,2,3,3-pentamethyl-2,5,6,7-tetrahydroindene-4,4-diol |
| SMILES | CC1C(C)(C)C2=C(C(O)(O)CCC2)C1(C)C |
| InChI | InChI=1S/C14H24O2/c1-9-12(2,3)10-7-6-8-14(15,16)11(10)13(9,4)5/h9,15-16H,6-8H2,1-5H3 |
| InChIKey | GNAGUGHQWNCQML-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|