C27H27Cl2N3O2 — CID 91591990
5-(5,6-dichloro-1H-indol-2-yl)-2-methoxy-N-(8-phenyl-8-azabicyclo[3.2.1]octan-3-yl)penta-2,4-dienamide (PubChem CID 91591990) has the molecular formula C27H27Cl2N3O2 and a molecular weight of 496.44 g/mol. Its IUPAC name is 5-(5,6-dichloro-1H-indol-2-yl)-2-methoxy-N-(8-phenyl-8-azabicyclo[3.2.1]octan-3-yl)penta-2,4-dienamide.
| Compound Name | 5-(5,6-dichloro-1H-indol-2-yl)-2-methoxy-N-(8-phenyl-8-azabicyclo[3.2.1]octan-3-yl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 91591990 |
| Molecular Formula | C27H27Cl2N3O2 |
| Molecular Weight | 496.44 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | 5-(5,6-dichloro-1H-indol-2-yl)-2-methoxy-N-(8-phenyl-8-azabicyclo[3.2.1]octan-3-yl)penta-2,4-dienamide |
| SMILES | COC(=CC=Cc1cc2cc(Cl)c(Cl)cc2[nH]1)C(=O)NC1CC2CCC(C1)N2c1ccccc1 |
| InChI | InChI=1S/C27H27Cl2N3O2/c1-34-26(9-5-6-18-12-17-13-23(28)24(29)16-25(17)30-18)27(33)31-19-14-21-10-11-22(15-19)32(21)20-7-3-2-4-8-20/h2-9,12-13,16,19,21-22,30H,10-11,14-15H2,1H3,(H,31,33) |
| InChIKey | RPWJATHGOWNVIP-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.44 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|