About 3-(4-methylidenecyclohexa-1,5-dien-1-yl)propanoic acid
3-(4-methylidenecyclohexa-1,5-dien-1-yl)propanoic acid (PubChem CID 91592718) has the molecular formula C10H12O2
and a molecular weight of 164.20 g/mol. Its IUPAC name is 3-(4-methylidenecyclohexa-1,5-dien-1-yl)propanoic acid.
Molecular Properties
| Compound Name | 3-(4-methylidenecyclohexa-1,5-dien-1-yl)propanoic acid |
| PubChem CID | 91592718 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 3-(4-methylidenecyclohexa-1,5-dien-1-yl)propanoic acid |
| SMILES | C=C1C=CC(CCC(=O)O)=CC1 |
| InChI | InChI=1S/C10H12O2/c1-8-2-4-9(5-3-8)6-7-10(11)12/h2,4-5H,1,3,6-7H2,(H,11,12) |
| InChIKey | CJJSPNIVFIEPBI-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(4-methylidenecyclohexa-1,5-dien-1-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methylidenecyclohexa-1,5-dien-1-yl)propanoic acid?
The IUPAC name of 3-(4-methylidenecyclohexa-1,5-dien-1-yl)propanoic acid (CID 91592718) is 3-(4-methylidenecyclohexa-1,5-dien-1-yl)propanoic acid.
What is the SMILES notation for 3-(4-methylidenecyclohexa-1,5-dien-1-yl)propanoic acid?
The canonical SMILES for 3-(4-methylidenecyclohexa-1,5-dien-1-yl)propanoic acid is C=C1C=CC(CCC(=O)O)=CC1.
What is the InChIKey of 3-(4-methylidenecyclohexa-1,5-dien-1-yl)propanoic acid?
The InChIKey is CJJSPNIVFIEPBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2/c1-8-2-4-9(5-3-8)6-7-10(11)12/h2,4-5H,1,3,6-7H2,(H,11,12).
What are the key properties of 3-(4-methylidenecyclohexa-1,5-dien-1-yl)propanoic acid?
3-(4-methylidenecyclohexa-1,5-dien-1-yl)propanoic acid has a molecular weight of 164.20 g/mol, XLogP of 2.29, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methylidenecyclohexa-1,5-dien-1-yl)propanoic acid is sourced from PubChem (CID 91592718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).