About tert-butyl 3-[(1S,2S)-2-methylcyclopropyl]prop-2-enoate
tert-butyl 3-[(1S,2S)-2-methylcyclopropyl]prop-2-enoate (PubChem CID 91592915) has the molecular formula C11H18O2
and a molecular weight of 182.26 g/mol. Its IUPAC name is tert-butyl 3-[(1S,2S)-2-methylcyclopropyl]prop-2-enoate.
Molecular Properties
| Compound Name | tert-butyl 3-[(1S,2S)-2-methylcyclopropyl]prop-2-enoate |
| PubChem CID | 91592915 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | tert-butyl 3-[(1S,2S)-2-methylcyclopropyl]prop-2-enoate |
| SMILES | C[C@H]1C[C@@H]1C=CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H18O2/c1-8-7-9(8)5-6-10(12)13-11(2,3)4/h5-6,8-9H,7H2,1-4H3/t8-,9-/m0/s1 |
| InChIKey | YDEIXKXPUOWLKO-IUCAKERBSA-N |
| XLogP | 2.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 3-[(1S,2S)-2-methylcyclopropyl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-[(1S,2S)-2-methylcyclopropyl]prop-2-enoate?
The IUPAC name of tert-butyl 3-[(1S,2S)-2-methylcyclopropyl]prop-2-enoate (CID 91592915) is tert-butyl 3-[(1S,2S)-2-methylcyclopropyl]prop-2-enoate.
What is the SMILES notation for tert-butyl 3-[(1S,2S)-2-methylcyclopropyl]prop-2-enoate?
The canonical SMILES for tert-butyl 3-[(1S,2S)-2-methylcyclopropyl]prop-2-enoate is C[C@H]1C[C@@H]1C=CC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 3-[(1S,2S)-2-methylcyclopropyl]prop-2-enoate?
The InChIKey is YDEIXKXPUOWLKO-IUCAKERBSA-N. The full InChI is InChI=1S/C11H18O2/c1-8-7-9(8)5-6-10(12)13-11(2,3)4/h5-6,8-9H,7H2,1-4H3/t8-,9-/m0/s1.
What are the key properties of tert-butyl 3-[(1S,2S)-2-methylcyclopropyl]prop-2-enoate?
tert-butyl 3-[(1S,2S)-2-methylcyclopropyl]prop-2-enoate has a molecular weight of 182.26 g/mol, XLogP of 2.54, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-[(1S,2S)-2-methylcyclopropyl]prop-2-enoate is sourced from PubChem (CID 91592915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).