About CID 91593162
CID 91593162 (PubChem CID 91593162) has the molecular formula C29H19N2O7S-
and a molecular weight of 539.55 g/mol.
Molecular Properties
| Compound Name | CID 91593162 |
| PubChem CID | 91593162 |
| Molecular Formula | C29H19N2O7S- |
| Molecular Weight | 539.55 g/mol |
| Exact Mass | 539.09 |
| IUPAC Name | — |
| SMILES | [CH2-]c1cc(N2C(=O)c3ccc4c5c(ccc(c35)C2=O)C(=O)N(C)C4=O)ccc1-c1ccc(C)cc1S(=O)(=O)O |
| InChI | InChI=1S/C29H19N2O7S/c1-14-4-6-18(23(12-14)39(36,37)38)17-7-5-16(13-15(17)2)31-28(34)21-10-8-19-24-20(27(33)30(3)26(19)32)9-11-22(25(21)24)29(31)35/h4-13H,2H2,1,3H3,(H,36,37,38)/q-1 |
| InChIKey | HBNLGJCEVIIIAP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 129.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 539.55 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze CID 91593162 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 91593162?
The IUPAC name of CID 91593162 (CID 91593162) is not available.
What is the SMILES notation for CID 91593162?
The canonical SMILES for CID 91593162 is [CH2-]c1cc(N2C(=O)c3ccc4c5c(ccc(c35)C2=O)C(=O)N(C)C4=O)ccc1-c1ccc(C)cc1S(=O)(=O)O.
What is the InChIKey of CID 91593162?
The InChIKey is HBNLGJCEVIIIAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H19N2O7S/c1-14-4-6-18(23(12-14)39(36,37)38)17-7-5-16(13-15(17)2)31-28(34)21-10-8-19-24-20(27(33)30(3)26(19)32)9-11-22(25(21)24)29(31)35/h4-13H,2H2,1,3H3,(H,36,37,38)/q-1.
What are the key properties of CID 91593162?
CID 91593162 has a molecular weight of 539.55 g/mol, XLogP of 4.27, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 91593162 is sourced from PubChem (CID 91593162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).