C9H12N2 — CID 91593197
5,8,9,9a-tetrahydro-4aH-pyrido[2,3-b]azepine (PubChem CID 91593197) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is 5,8,9,9a-tetrahydro-4aH-pyrido[2,3-b]azepine.
| Compound Name | 5,8,9,9a-tetrahydro-4aH-pyrido[2,3-b]azepine |
|---|---|
| PubChem CID | 91593197 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 5,8,9,9a-tetrahydro-4aH-pyrido[2,3-b]azepine |
| SMILES | C1=CC2CC=CCNC2N=C1 |
| InChI | InChI=1S/C9H12N2/c1-2-6-10-9-8(4-1)5-3-7-11-9/h1-3,5,7-10H,4,6H2 |
| InChIKey | GPYNVFPFQVBXIT-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|