About N-[2-methyl-3-methylidene-5-(trifluoromethyl)hepta-1,4,6-trienyl]ethanimine
N-[2-methyl-3-methylidene-5-(trifluoromethyl)hepta-1,4,6-trienyl]ethanimine (PubChem CID 91593348) has the molecular formula C12H14F3N
and a molecular weight of 229.24 g/mol. Its IUPAC name is N-[2-methyl-3-methylidene-5-(trifluoromethyl)hepta-1,4,6-trienyl]ethanimine.
Molecular Properties
| Compound Name | N-[2-methyl-3-methylidene-5-(trifluoromethyl)hepta-1,4,6-trienyl]ethanimine |
| PubChem CID | 91593348 |
| Molecular Formula | C12H14F3N |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | N-[2-methyl-3-methylidene-5-(trifluoromethyl)hepta-1,4,6-trienyl]ethanimine |
| SMILES | C=CC(=CC(=C)C(C)=C/N=C/C)C(F)(F)F |
| InChI | InChI=1S/C12H14F3N/c1-5-11(12(13,14)15)7-9(3)10(4)8-16-6-2/h5-8H,1,3H2,2,4H3/b10-8?,11-7?,16-6+ |
| InChIKey | NMOMPVALNGEKKL-XLYOFIAJSA-N |
| XLogP | 4.21 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[2-methyl-3-methylidene-5-(trifluoromethyl)hepta-1,4,6-trienyl]ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-methyl-3-methylidene-5-(trifluoromethyl)hepta-1,4,6-trienyl]ethanimine?
The IUPAC name of N-[2-methyl-3-methylidene-5-(trifluoromethyl)hepta-1,4,6-trienyl]ethanimine (CID 91593348) is N-[2-methyl-3-methylidene-5-(trifluoromethyl)hepta-1,4,6-trienyl]ethanimine.
What is the SMILES notation for N-[2-methyl-3-methylidene-5-(trifluoromethyl)hepta-1,4,6-trienyl]ethanimine?
The canonical SMILES for N-[2-methyl-3-methylidene-5-(trifluoromethyl)hepta-1,4,6-trienyl]ethanimine is C=CC(=CC(=C)C(C)=C/N=C/C)C(F)(F)F.
What is the InChIKey of N-[2-methyl-3-methylidene-5-(trifluoromethyl)hepta-1,4,6-trienyl]ethanimine?
The InChIKey is NMOMPVALNGEKKL-XLYOFIAJSA-N. The full InChI is InChI=1S/C12H14F3N/c1-5-11(12(13,14)15)7-9(3)10(4)8-16-6-2/h5-8H,1,3H2,2,4H3/b10-8?,11-7?,16-6+.
What are the key properties of N-[2-methyl-3-methylidene-5-(trifluoromethyl)hepta-1,4,6-trienyl]ethanimine?
N-[2-methyl-3-methylidene-5-(trifluoromethyl)hepta-1,4,6-trienyl]ethanimine has a molecular weight of 229.24 g/mol, XLogP of 4.21, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-methyl-3-methylidene-5-(trifluoromethyl)hepta-1,4,6-trienyl]ethanimine is sourced from PubChem (CID 91593348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).