C13H28N2 — CID 91593500
7-ethyl-1-N,4-N-dimethylcyclononane-1,4-diamine (PubChem CID 91593500) has the molecular formula C13H28N2 and a molecular weight of 212.38 g/mol. Its IUPAC name is 7-ethyl-1-N,4-N-dimethylcyclononane-1,4-diamine.
| Compound Name | 7-ethyl-1-N,4-N-dimethylcyclononane-1,4-diamine |
|---|---|
| PubChem CID | 91593500 |
| Molecular Formula | C13H28N2 |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.23 |
| IUPAC Name | 7-ethyl-1-N,4-N-dimethylcyclononane-1,4-diamine |
| SMILES | CCC1CCC(NC)CCC(NC)CC1 |
| InChI | InChI=1S/C13H28N2/c1-4-11-5-7-12(14-2)9-10-13(15-3)8-6-11/h11-15H,4-10H2,1-3H3 |
| InChIKey | BRSDDODGLIEGNC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |