About 3-trimethylsilylpropyl 3,3,4-trimethylpent-4-enoate
3-trimethylsilylpropyl 3,3,4-trimethylpent-4-enoate (PubChem CID 91593558) has the molecular formula C14H28O2Si
and a molecular weight of 256.46 g/mol. Its IUPAC name is 3-trimethylsilylpropyl 3,3,4-trimethylpent-4-enoate.
Molecular Properties
| Compound Name | 3-trimethylsilylpropyl 3,3,4-trimethylpent-4-enoate |
| PubChem CID | 91593558 |
| Molecular Formula | C14H28O2Si |
| Molecular Weight | 256.46 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 3-trimethylsilylpropyl 3,3,4-trimethylpent-4-enoate |
| SMILES | C=C(C)C(C)(C)CC(=O)OCCC[Si](C)(C)C |
| InChI | InChI=1S/C14H28O2Si/c1-12(2)14(3,4)11-13(15)16-9-8-10-17(5,6)7/h1,8-11H2,2-7H3 |
| InChIKey | LYYPSIBWMMMIAN-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-trimethylsilylpropyl 3,3,4-trimethylpent-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-trimethylsilylpropyl 3,3,4-trimethylpent-4-enoate?
The IUPAC name of 3-trimethylsilylpropyl 3,3,4-trimethylpent-4-enoate (CID 91593558) is 3-trimethylsilylpropyl 3,3,4-trimethylpent-4-enoate.
What is the SMILES notation for 3-trimethylsilylpropyl 3,3,4-trimethylpent-4-enoate?
The canonical SMILES for 3-trimethylsilylpropyl 3,3,4-trimethylpent-4-enoate is C=C(C)C(C)(C)CC(=O)OCCC[Si](C)(C)C.
What is the InChIKey of 3-trimethylsilylpropyl 3,3,4-trimethylpent-4-enoate?
The InChIKey is LYYPSIBWMMMIAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O2Si/c1-12(2)14(3,4)11-13(15)16-9-8-10-17(5,6)7/h1,8-11H2,2-7H3.
What are the key properties of 3-trimethylsilylpropyl 3,3,4-trimethylpent-4-enoate?
3-trimethylsilylpropyl 3,3,4-trimethylpent-4-enoate has a molecular weight of 256.46 g/mol, XLogP of 4.25, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-trimethylsilylpropyl 3,3,4-trimethylpent-4-enoate is sourced from PubChem (CID 91593558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).