C16H10O8 — CID 91594004
1-acetyl-2,4,5,7,8-pentahydroxyanthracene-9,10-dione (PubChem CID 91594004) has the molecular formula C16H10O8 and a molecular weight of 330.25 g/mol. Its IUPAC name is 1-acetyl-2,4,5,7,8-pentahydroxyanthracene-9,10-dione.
| Compound Name | 1-acetyl-2,4,5,7,8-pentahydroxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 91594004 |
| Molecular Formula | C16H10O8 |
| Molecular Weight | 330.25 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 1-acetyl-2,4,5,7,8-pentahydroxyanthracene-9,10-dione |
| SMILES | CC(=O)c1c(O)cc(O)c2c1C(=O)c1c(O)c(O)cc(O)c1C2=O |
| InChI | InChI=1S/C16H10O8/c1-4(17)9-5(18)2-6(19)10-12(9)16(24)13-11(15(10)23)7(20)3-8(21)14(13)22/h2-3,18-22H,1H3 |
| InChIKey | AXSPBDVPZVAVRT-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 152.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.25 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|