C19H25N5O4 — CID 91594343
tert-butyl 2-[[1-(2-azidopropyl)-8,9-dihydro-7H-pyrano[2,3-g]indazol-8-yl]oxy]acetate (PubChem CID 91594343) has the molecular formula C19H25N5O4 and a molecular weight of 387.44 g/mol. Its IUPAC name is tert-butyl 2-[[1-(2-azidopropyl)-8,9-dihydro-7H-pyrano[2,3-g]indazol-8-yl]oxy]acetate.
| Compound Name | tert-butyl 2-[[1-(2-azidopropyl)-8,9-dihydro-7H-pyrano[2,3-g]indazol-8-yl]oxy]acetate |
|---|---|
| PubChem CID | 91594343 |
| Molecular Formula | C19H25N5O4 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | tert-butyl 2-[[1-(2-azidopropyl)-8,9-dihydro-7H-pyrano[2,3-g]indazol-8-yl]oxy]acetate |
| SMILES | CC(Cn1ncc2ccc3c(c21)CC(OCC(=O)OC(C)(C)C)CO3)N=[N+]=[N-] |
| InChI | InChI=1S/C19H25N5O4/c1-12(22-23-20)9-24-18-13(8-21-24)5-6-16-15(18)7-14(10-27-16)26-11-17(25)28-19(2,3)4/h5-6,8,12,14H,7,9-11H2,1-4H3 |
| InChIKey | GGPVRIBLAWXCER-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 111.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|