C21H28FN3O2 — CID 91594424
N'-[2-fluoro-5-[(2R,5S)-5-methyl-6-oxo-3-phenyl-2-propan-2-yl-2H-1,4-oxazin-5-yl]pent-2-enyl]ethanimidamide (PubChem CID 91594424) has the molecular formula C21H28FN3O2 and a molecular weight of 373.47 g/mol. Its IUPAC name is N'-[2-fluoro-5-[(2R,5S)-5-methyl-6-oxo-3-phenyl-2-propan-2-yl-2H-1,4-oxazin-5-yl]pent-2-enyl]ethanimidamide.
| Compound Name | N'-[2-fluoro-5-[(2R,5S)-5-methyl-6-oxo-3-phenyl-2-propan-2-yl-2H-1,4-oxazin-5-yl]pent-2-enyl]ethanimidamide |
|---|---|
| PubChem CID | 91594424 |
| Molecular Formula | C21H28FN3O2 |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | N'-[2-fluoro-5-[(2R,5S)-5-methyl-6-oxo-3-phenyl-2-propan-2-yl-2H-1,4-oxazin-5-yl]pent-2-enyl]ethanimidamide |
| SMILES | C/C(N)=N\CC(F)=CCC[C@]1(C)N=C(c2ccccc2)[C@@H](C(C)C)OC1=O |
| InChI | InChI=1S/C21H28FN3O2/c1-14(2)19-18(16-9-6-5-7-10-16)25-21(4,20(26)27-19)12-8-11-17(22)13-24-15(3)23/h5-7,9-11,14,19H,8,12-13H2,1-4H3,(H2,23,24)/t19-,21+/m1/s1 |
| InChIKey | WMOPXBHEGFRAKG-CTNGQTDRSA-N |
| XLogP | 3.83 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|