About ethane;2-methylidene-1,3-dihydroindole
ethane;2-methylidene-1,3-dihydroindole (PubChem CID 91594681) has the molecular formula C11H15N
and a molecular weight of 161.25 g/mol. Its IUPAC name is ethane;2-methylidene-1,3-dihydroindole.
Molecular Properties
| Compound Name | ethane;2-methylidene-1,3-dihydroindole |
| PubChem CID | 91594681 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | ethane;2-methylidene-1,3-dihydroindole |
| SMILES | C=C1Cc2ccccc2N1.CC |
| InChI | InChI=1S/C9H9N.C2H6/c1-7-6-8-4-2-3-5-9(8)10-7;1-2/h2-5,10H,1,6H2;1-2H3 |
| InChIKey | XBRYOLUULSVSLN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;2-methylidene-1,3-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylidene-1,3-dihydroindole?
The IUPAC name of ethane;2-methylidene-1,3-dihydroindole (CID 91594681) is ethane;2-methylidene-1,3-dihydroindole.
What is the SMILES notation for ethane;2-methylidene-1,3-dihydroindole?
The canonical SMILES for ethane;2-methylidene-1,3-dihydroindole is C=C1Cc2ccccc2N1.CC.
What is the InChIKey of ethane;2-methylidene-1,3-dihydroindole?
The InChIKey is XBRYOLUULSVSLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N.C2H6/c1-7-6-8-4-2-3-5-9(8)10-7;1-2/h2-5,10H,1,6H2;1-2H3.
What are the key properties of ethane;2-methylidene-1,3-dihydroindole?
ethane;2-methylidene-1,3-dihydroindole has a molecular weight of 161.25 g/mol, XLogP of 3.19, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylidene-1,3-dihydroindole is sourced from PubChem (CID 91594681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).