About methyl N-[5-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]furan-2-yl]carbamate
methyl N-[5-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]furan-2-yl]carbamate (PubChem CID 91594704) has the molecular formula C19H15BrF2N2O5
and a molecular weight of 469.24 g/mol. Its IUPAC name is methyl N-[5-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]furan-2-yl]carbamate.
Molecular Properties
| Compound Name | methyl N-[5-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]furan-2-yl]carbamate |
| PubChem CID | 91594704 |
| Molecular Formula | C19H15BrF2N2O5 |
| Molecular Weight | 469.24 g/mol |
| Exact Mass | 468.01 |
| IUPAC Name | methyl N-[5-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]furan-2-yl]carbamate |
| SMILES | COC(=O)Nc1ccc(-n2c(C)cc(OCc3ccc(F)cc3F)c(Br)c2=O)o1 |
| InChI | InChI=1S/C19H15BrF2N2O5/c1-10-7-14(28-9-11-3-4-12(21)8-13(11)22)17(20)18(25)24(10)16-6-5-15(29-16)23-19(26)27-2/h3-8H,9H2,1-2H3,(H,23,26) |
| InChIKey | HPCYXTQYTKQUOG-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 469.24 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl N-[5-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]furan-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[5-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]furan-2-yl]carbamate?
The IUPAC name of methyl N-[5-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]furan-2-yl]carbamate (CID 91594704) is methyl N-[5-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]furan-2-yl]carbamate.
What is the SMILES notation for methyl N-[5-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]furan-2-yl]carbamate?
The canonical SMILES for methyl N-[5-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]furan-2-yl]carbamate is COC(=O)Nc1ccc(-n2c(C)cc(OCc3ccc(F)cc3F)c(Br)c2=O)o1.
What is the InChIKey of methyl N-[5-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]furan-2-yl]carbamate?
The InChIKey is HPCYXTQYTKQUOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15BrF2N2O5/c1-10-7-14(28-9-11-3-4-12(21)8-13(11)22)17(20)18(25)24(10)16-6-5-15(29-16)23-19(26)27-2/h3-8H,9H2,1-2H3,(H,23,26).
What are the key properties of methyl N-[5-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]furan-2-yl]carbamate?
methyl N-[5-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]furan-2-yl]carbamate has a molecular weight of 469.24 g/mol, XLogP of 4.54, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[5-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]furan-2-yl]carbamate is sourced from PubChem (CID 91594704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).