C14H20N2O2 — CID 91594789
6-(3-hydroxy-3,4-dimethylpent-1-ynyl)-2-propan-2-ylpyridazin-3-one (PubChem CID 91594789) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 6-(3-hydroxy-3,4-dimethylpent-1-ynyl)-2-propan-2-ylpyridazin-3-one.
| Compound Name | 6-(3-hydroxy-3,4-dimethylpent-1-ynyl)-2-propan-2-ylpyridazin-3-one |
|---|---|
| PubChem CID | 91594789 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 6-(3-hydroxy-3,4-dimethylpent-1-ynyl)-2-propan-2-ylpyridazin-3-one |
| SMILES | CC(C)n1nc(C#CC(C)(O)C(C)C)ccc1=O |
| InChI | InChI=1S/C14H20N2O2/c1-10(2)14(5,18)9-8-12-6-7-13(17)16(15-12)11(3)4/h6-7,10-11,18H,1-5H3 |
| InChIKey | QJUFYXDXVVXKTJ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|